C22H16N2O2S2 — CID 154324834
2-sulfanylidene-5-[[7-[2-(2,4,5-trimethylphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 154324834) has the molecular formula C22H16N2O2S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-sulfanylidene-5-[[7-[2-(2,4,5-trimethylphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-sulfanylidene-5-[[7-[2-(2,4,5-trimethylphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 154324834 |
| Molecular Formula | C22H16N2O2S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-sulfanylidene-5-[[7-[2-(2,4,5-trimethylphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)c(C#Cc2cncc3cc(C=C4SC(=S)NC4=O)oc23)cc1C |
| InChI | InChI=1S/C22H16N2O2S2/c1-12-6-14(3)15(7-13(12)2)4-5-16-10-23-11-17-8-18(26-20(16)17)9-19-21(25)24-22(27)28-19/h6-11H,1-3H3,(H,24,25,27) |
| InChIKey | QESXBIBBRMWMKV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|