C19H8F2N2O3S — CID 118090453
(5E)-5-[[7-[2-(3,4-difluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118090453) has the molecular formula C19H8F2N2O3S and a molecular weight of 382.35 g/mol. Its IUPAC name is (5E)-5-[[7-[2-(3,4-difluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[7-[2-(3,4-difluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118090453 |
| Molecular Formula | C19H8F2N2O3S |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | (5E)-5-[[7-[2-(3,4-difluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2cc3cncc(C#Cc4ccc(F)c(F)c4)c3o2)S1 |
| InChI | InChI=1S/C19H8F2N2O3S/c20-14-4-2-10(5-15(14)21)1-3-11-8-22-9-12-6-13(26-17(11)12)7-16-18(24)23-19(25)27-16/h2,4-9H,(H,23,24,25)/b16-7+ |
| InChIKey | JXVFEOHYSJTAAO-FRKPEAEDSA-N |
| XLogP | 3.83 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|