C21H12N2O4S — CID 118090654
(5E)-5-[[7-[2-(4-acetylphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118090654) has the molecular formula C21H12N2O4S and a molecular weight of 388.40 g/mol. Its IUPAC name is (5E)-5-[[7-[2-(4-acetylphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[7-[2-(4-acetylphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118090654 |
| Molecular Formula | C21H12N2O4S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | (5E)-5-[[7-[2-(4-acetylphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(=O)c1ccc(C#Cc2cncc3cc(/C=C4/SC(=O)NC4=O)oc23)cc1 |
| InChI | InChI=1S/C21H12N2O4S/c1-12(24)14-5-2-13(3-6-14)4-7-15-10-22-11-16-8-17(27-19(15)16)9-18-20(25)23-21(26)28-18/h2-3,5-6,8-11H,1H3,(H,23,25,26)/b18-9+ |
| InChIKey | BIWKWNJVAVNMKM-GIJQJNRQSA-N |
| XLogP | 3.75 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|