C17H8N2O2S3 — CID 154199942
2-sulfanylidene-5-[[7-(2-thiophen-3-ylethynyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 154199942) has the molecular formula C17H8N2O2S3 and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-sulfanylidene-5-[[7-(2-thiophen-3-ylethynyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-sulfanylidene-5-[[7-(2-thiophen-3-ylethynyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 154199942 |
| Molecular Formula | C17H8N2O2S3 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 2-sulfanylidene-5-[[7-(2-thiophen-3-ylethynyl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)SC1=Cc1cc2cncc(C#Cc3ccsc3)c2o1 |
| InChI | InChI=1S/C17H8N2O2S3/c20-16-14(24-17(22)19-16)6-13-5-12-8-18-7-11(15(12)21-13)2-1-10-3-4-23-9-10/h3-9H,(H,19,20,22) |
| InChIKey | GKAOMOOFGDBQHX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|