C19H8F2N2O2S2 — CID 118089788
(5Z)-5-[[7-[2-(3,4-difluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 118089788) has the molecular formula C19H8F2N2O2S2 and a molecular weight of 398.42 g/mol. Its IUPAC name is (5Z)-5-[[7-[2-(3,4-difluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[7-[2-(3,4-difluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 118089788 |
| Molecular Formula | C19H8F2N2O2S2 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | (5Z)-5-[[7-[2-(3,4-difluorophenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1cc2cncc(C#Cc3ccc(F)c(F)c3)c2o1 |
| InChI | InChI=1S/C19H8F2N2O2S2/c20-14-4-2-10(5-15(14)21)1-3-11-8-22-9-12-6-13(25-17(11)12)7-16-18(24)23-19(26)27-16/h2,4-9H,(H,23,24,26)/b16-7- |
| InChIKey | CRYMQXBPMCYYTC-APSNUPSMSA-N |
| XLogP | 3.99 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|