C19H10N2O4S — CID 118090722
(5Z)-5-[[7-[2-(2-hydroxyphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118090722) has the molecular formula C19H10N2O4S and a molecular weight of 362.37 g/mol. Its IUPAC name is (5Z)-5-[[7-[2-(2-hydroxyphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[7-[2-(2-hydroxyphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118090722 |
| Molecular Formula | C19H10N2O4S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | (5Z)-5-[[7-[2-(2-hydroxyphenyl)ethynyl]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc3cncc(C#Cc4ccccc4O)c3o2)S1 |
| InChI | InChI=1S/C19H10N2O4S/c22-15-4-2-1-3-11(15)5-6-12-9-20-10-13-7-14(25-17(12)13)8-16-18(23)21-19(24)26-16/h1-4,7-10,22H,(H,21,23,24)/b16-8- |
| InChIKey | BZBAPVQUBAKZKN-PXNMLYILSA-N |
| XLogP | 3.26 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|