C18H9N3O3S2 — CID 118090074
(5E)-5-[[7-(1,3-benzothiazol-2-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118090074) has the molecular formula C18H9N3O3S2 and a molecular weight of 379.42 g/mol. Its IUPAC name is (5E)-5-[[7-(1,3-benzothiazol-2-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[7-(1,3-benzothiazol-2-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118090074 |
| Molecular Formula | C18H9N3O3S2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | (5E)-5-[[7-(1,3-benzothiazol-2-yl)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2cc3cncc(-c4nc5ccccc5s4)c3o2)S1 |
| InChI | InChI=1S/C18H9N3O3S2/c22-16-14(26-18(23)21-16)6-10-5-9-7-19-8-11(15(9)24-10)17-20-12-3-1-2-4-13(12)25-17/h1-8H,(H,21,22,23)/b14-6+ |
| InChIKey | YQLFOANUOQNPLJ-MKMNVTDBSA-N |
| XLogP | 4.43 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|