C17H10ClN3O3S — CID 118089897
(5Z)-5-[[7-(4-chloroanilino)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118089897) has the molecular formula C17H10ClN3O3S and a molecular weight of 371.81 g/mol. Its IUPAC name is (5Z)-5-[[7-(4-chloroanilino)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[7-(4-chloroanilino)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118089897 |
| Molecular Formula | C17H10ClN3O3S |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | (5Z)-5-[[7-(4-chloroanilino)furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc3cncc(Nc4ccc(Cl)cc4)c3o2)S1 |
| InChI | InChI=1S/C17H10ClN3O3S/c18-10-1-3-11(4-2-10)20-13-8-19-7-9-5-12(24-15(9)13)6-14-16(22)21-17(23)25-14/h1-8,20H,(H,21,22,23)/b14-6- |
| InChIKey | QMRCKUOPAFNDPV-NSIKDUERSA-N |
| XLogP | 4.55 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|