C19H13Cl2N3O3S — CID 118089524
(5Z)-5-[[7-[2-(2,4-dichlorophenyl)ethylamino]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118089524) has the molecular formula C19H13Cl2N3O3S and a molecular weight of 434.30 g/mol. Its IUPAC name is (5Z)-5-[[7-[2-(2,4-dichlorophenyl)ethylamino]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[7-[2-(2,4-dichlorophenyl)ethylamino]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118089524 |
| Molecular Formula | C19H13Cl2N3O3S |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | (5Z)-5-[[7-[2-(2,4-dichlorophenyl)ethylamino]furo[3,2-c]pyridin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc3cncc(NCCc4ccc(Cl)cc4Cl)c3o2)S1 |
| InChI | InChI=1S/C19H13Cl2N3O3S/c20-12-2-1-10(14(21)6-12)3-4-23-15-9-22-8-11-5-13(27-17(11)15)7-16-18(25)24-19(26)28-16/h1-2,5-9,23H,3-4H2,(H,24,25,26)/b16-7- |
| InChIKey | MVHRJOPIZMVYHF-APSNUPSMSA-N |
| XLogP | 5.11 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|