C25H22ClNO3 — CID 142720887
[1-butyl-5-(4-chlorophenoxy)indol-3-yl]-(4-hydroxyphenyl)methanone (PubChem CID 142720887) has the molecular formula C25H22ClNO3 and a molecular weight of 419.91 g/mol. Its IUPAC name is [1-butyl-5-(4-chlorophenoxy)indol-3-yl]-(4-hydroxyphenyl)methanone.
| Compound Name | [1-butyl-5-(4-chlorophenoxy)indol-3-yl]-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 142720887 |
| Molecular Formula | C25H22ClNO3 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | [1-butyl-5-(4-chlorophenoxy)indol-3-yl]-(4-hydroxyphenyl)methanone |
| SMILES | CCCCn1cc(C(=O)c2ccc(O)cc2)c2cc(Oc3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C25H22ClNO3/c1-2-3-14-27-16-23(25(29)17-4-8-19(28)9-5-17)22-15-21(12-13-24(22)27)30-20-10-6-18(26)7-11-20/h4-13,15-16,28H,2-3,14H2,1H3 |
| InChIKey | CSDGMRPLXWGJOJ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |