C19H14F3N3O3S — CID 142723007
2-[5-(2,5-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]-N-(oxomethylidene)benzenesulfonamide (PubChem CID 142723007) has the molecular formula C19H14F3N3O3S and a molecular weight of 421.40 g/mol. Its IUPAC name is 2-[5-(2,5-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]-N-(oxomethylidene)benzenesulfonamide.
| Compound Name | 2-[5-(2,5-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]-N-(oxomethylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 142723007 |
| Molecular Formula | C19H14F3N3O3S |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 2-[5-(2,5-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]-N-(oxomethylidene)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(-c2cc(C(F)(F)F)nn2-c2ccccc2S(=O)(=O)N=C=O)c1 |
| InChI | InChI=1S/C19H14F3N3O3S/c1-12-7-8-13(2)14(9-12)16-10-18(19(20,21)22)24-25(16)15-5-3-4-6-17(15)29(27,28)23-11-26/h3-10H,1-2H3 |
| InChIKey | VWQROOGCKONPOG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|