C17H18ClFO2 — CID 142726656
1-(4-chloro-3-fluorophenyl)undeca-2,4-diyne-1,6-diol (PubChem CID 142726656) has the molecular formula C17H18ClFO2 and a molecular weight of 308.78 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)undeca-2,4-diyne-1,6-diol.
| Compound Name | 1-(4-chloro-3-fluorophenyl)undeca-2,4-diyne-1,6-diol |
|---|---|
| PubChem CID | 142726656 |
| Molecular Formula | C17H18ClFO2 |
| Molecular Weight | 308.78 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)undeca-2,4-diyne-1,6-diol |
| SMILES | CCCCCC(O)C#CC#CC(O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C17H18ClFO2/c1-2-3-4-7-14(20)8-5-6-9-17(21)13-10-11-15(18)16(19)12-13/h10-12,14,17,20-21H,2-4,7H2,1H3 |
| InChIKey | BMZJXFLKENHUAZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.78 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|