C20H21NO2S — CID 142730306
(3E)-N-butyl-6-methoxy-3-(thiophen-2-ylmethylidene)indene-1-carboxamide (PubChem CID 142730306) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is (3E)-N-butyl-6-methoxy-3-(thiophen-2-ylmethylidene)indene-1-carboxamide.
| Compound Name | (3E)-N-butyl-6-methoxy-3-(thiophen-2-ylmethylidene)indene-1-carboxamide |
|---|---|
| PubChem CID | 142730306 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (3E)-N-butyl-6-methoxy-3-(thiophen-2-ylmethylidene)indene-1-carboxamide |
| SMILES | CCCCNC(=O)C1=C/C(=C\c2cccs2)c2ccc(OC)cc21 |
| InChI | InChI=1S/C20H21NO2S/c1-3-4-9-21-20(22)19-12-14(11-16-6-5-10-24-16)17-8-7-15(23-2)13-18(17)19/h5-8,10-13H,3-4,9H2,1-2H3,(H,21,22)/b14-11+ |
| InChIKey | QKUJMZONGVPAMP-SDNWHVSQSA-N |
| XLogP | 4.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|