C21H26N4O3 — CID 143493536
4-amino-N-butyl-8-(2,5-dimethoxyphenyl)-1,2-dihydrocinnoline-3-carboxamide (PubChem CID 143493536) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 4-amino-N-butyl-8-(2,5-dimethoxyphenyl)-1,2-dihydrocinnoline-3-carboxamide.
| Compound Name | 4-amino-N-butyl-8-(2,5-dimethoxyphenyl)-1,2-dihydrocinnoline-3-carboxamide |
|---|---|
| PubChem CID | 143493536 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 4-amino-N-butyl-8-(2,5-dimethoxyphenyl)-1,2-dihydrocinnoline-3-carboxamide |
| SMILES | CCCCNC(=O)C1=C(N)c2cccc(-c3cc(OC)ccc3OC)c2NN1 |
| InChI | InChI=1S/C21H26N4O3/c1-4-5-11-23-21(26)20-18(22)15-8-6-7-14(19(15)24-25-20)16-12-13(27-2)9-10-17(16)28-3/h6-10,12,24-25H,4-5,11,22H2,1-3H3,(H,23,26) |
| InChIKey | FFZUSDVQIIFHSH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|