C9H10N2O — CID 142733342
2-methyl-5-phenyl-5H-1,2,4-oxadiazole (PubChem CID 142733342) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-methyl-5-phenyl-5H-1,2,4-oxadiazole.
| Compound Name | 2-methyl-5-phenyl-5H-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 142733342 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-methyl-5-phenyl-5H-1,2,4-oxadiazole |
| SMILES | CN1C=NC(c2ccccc2)O1 |
| InChI | InChI=1S/C9H10N2O/c1-11-7-10-9(12-11)8-5-3-2-4-6-8/h2-7,9H,1H3 |
| InChIKey | CFFMNMUTFMRAGU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |