About N-ethenyl-N-propylaniline;methanol;titanium
N-ethenyl-N-propylaniline;methanol;titanium (PubChem CID 142734850) has the molecular formula C14H26NO3Ti-
and a molecular weight of 304.23 g/mol. Its IUPAC name is N-ethenyl-N-propylaniline;methanol;titanium.
Molecular Properties
| Compound Name | N-ethenyl-N-propylaniline;methanol;titanium |
| PubChem CID | 142734850 |
| Molecular Formula | C14H26NO3Ti- |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-ethenyl-N-propylaniline;methanol;titanium |
| SMILES | C=CN(CC[CH2-])c1ccccc1.CO.CO.CO.[Ti] |
| InChI | InChI=1S/C11H14N.3CH4O.Ti/c1-3-10-12(4-2)11-8-6-5-7-9-11;3*1-2;/h4-9H,1-3,10H2;3*2H,1H3;/q-1;;;; |
| InChIKey | IXNSYAGFOXPGKZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N-propylaniline;methanol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N-propylaniline;methanol;titanium?
The IUPAC name of N-ethenyl-N-propylaniline;methanol;titanium (CID 142734850) is N-ethenyl-N-propylaniline;methanol;titanium.
What is the SMILES notation for N-ethenyl-N-propylaniline;methanol;titanium?
The canonical SMILES for N-ethenyl-N-propylaniline;methanol;titanium is C=CN(CC[CH2-])c1ccccc1.CO.CO.CO.[Ti].
What is the InChIKey of N-ethenyl-N-propylaniline;methanol;titanium?
The InChIKey is IXNSYAGFOXPGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N.3CH4O.Ti/c1-3-10-12(4-2)11-8-6-5-7-9-11;3*1-2;/h4-9H,1-3,10H2;3*2H,1H3;/q-1;;;;.
What are the key properties of N-ethenyl-N-propylaniline;methanol;titanium?
N-ethenyl-N-propylaniline;methanol;titanium has a molecular weight of 304.23 g/mol, XLogP of 1.68, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N-propylaniline;methanol;titanium is sourced from PubChem (CID 142734850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).