C26H24ClN5O5 — CID 142740107
ethyl 2-[[4-[[(1S)-1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethyl]amino]-3-nitro-2-pyridinyl]amino]acetate (PubChem CID 142740107) has the molecular formula C26H24ClN5O5 and a molecular weight of 521.96 g/mol. Its IUPAC name is ethyl 2-[[4-[[(1S)-1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethyl]amino]-3-nitro-2-pyridinyl]amino]acetate.
| Compound Name | ethyl 2-[[4-[[(1S)-1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethyl]amino]-3-nitro-2-pyridinyl]amino]acetate |
|---|---|
| PubChem CID | 142740107 |
| Molecular Formula | C26H24ClN5O5 |
| Molecular Weight | 521.96 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | ethyl 2-[[4-[[(1S)-1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethyl]amino]-3-nitro-2-pyridinyl]amino]acetate |
| SMILES | CCOC(=O)CNc1nccc(N[C@@H](C)c2cc3cccc(Cl)c3c(=O)n2-c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H24ClN5O5/c1-3-37-22(33)15-29-25-24(32(35)36)20(12-13-28-25)30-16(2)21-14-17-8-7-11-19(27)23(17)26(34)31(21)18-9-5-4-6-10-18/h4-14,16H,3,15H2,1-2H3,(H2,28,29,30)/t16-/m0/s1 |
| InChIKey | XZTGEVHNDMHOAW-INIZCTEOSA-N |
| XLogP | 5.10 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.96 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|