C20H30Ru — CID 142741028
bis(5-methyl-2-propan-2-ylcyclohexa-1,3-diene);ruthenium(2+) (PubChem CID 142741028) has the molecular formula C20H30Ru and a molecular weight of 371.53 g/mol. Its IUPAC name is bis(5-methyl-2-propan-2-ylcyclohexa-1,3-diene);ruthenium(2+).
| Compound Name | bis(5-methyl-2-propan-2-ylcyclohexa-1,3-diene);ruthenium(2+) |
|---|---|
| PubChem CID | 142741028 |
| Molecular Formula | C20H30Ru |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | bis(5-methyl-2-propan-2-ylcyclohexa-1,3-diene);ruthenium(2+) |
| SMILES | C[C-]1C=CC(C(C)C)=CC1.C[C-]1C=CC(C(C)C)=CC1.[Ru+2] |
| InChI | InChI=1S/2C10H15.Ru/c2*1-8(2)10-6-4-9(3)5-7-10;/h2*4,6-8H,5H2,1-3H3;/q2*-1;+2 |
| InChIKey | PBTBOKHUKCFTBD-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|