C12H22NO3- — CID 14274507
2,2,6,6-tetramethyl-1-oxido-4-(oxiran-2-ylmethoxy)piperidine (PubChem CID 14274507) has the molecular formula C12H22NO3- and a molecular weight of 228.31 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-oxido-4-(oxiran-2-ylmethoxy)piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-oxido-4-(oxiran-2-ylmethoxy)piperidine |
|---|---|
| PubChem CID | 14274507 |
| Molecular Formula | C12H22NO3- |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-oxido-4-(oxiran-2-ylmethoxy)piperidine |
| SMILES | CC1(C)CC(OCC2CO2)CC(C)(C)N1[O-] |
| InChI | InChI=1S/C12H22NO3/c1-11(2)5-9(15-7-10-8-16-10)6-12(3,4)13(11)14/h9-10H,5-8H2,1-4H3/q-1 |
| InChIKey | JGUSVQZPMJWRMZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|