C29H34O4 — CID 142748113
bis(2-propylphenyl) 7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 142748113) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is bis(2-propylphenyl) 7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(2-propylphenyl) 7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142748113 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | bis(2-propylphenyl) 7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCCc1ccccc1OC(=O)C1C(C(=O)Oc2ccccc2CCC)C2C=CC1C2(C)C |
| InChI | InChI=1S/C29H34O4/c1-5-11-19-13-7-9-15-23(19)32-27(30)25-21-17-18-22(29(21,3)4)26(25)28(31)33-24-16-10-8-14-20(24)12-6-2/h7-10,13-18,21-22,25-26H,5-6,11-12H2,1-4H3 |
| InChIKey | FZCXECRTEWDBAY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|