C18H17N5O4S — CID 142748550
(5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-3-piperidin-4-yl-1,3-thiazolidine-2,4-dione (PubChem CID 142748550) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is (5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-3-piperidin-4-yl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-3-piperidin-4-yl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 142748550 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | (5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-3-piperidin-4-yl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccn(-c3ccc([N+](=O)[O-])cc3)n2)C(=O)N1C1CCNCC1 |
| InChI | InChI=1S/C18H17N5O4S/c24-17-16(28-18(25)22(17)14-5-8-19-9-6-14)11-12-7-10-21(20-12)13-1-3-15(4-2-13)23(26)27/h1-4,7,10-11,14,19H,5-6,8-9H2/b16-11- |
| InChIKey | CYFNHFRTMYWIDW-WJDWOHSUSA-N |
| XLogP | 2.57 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|