C19H18N4O6S — CID 142748593
6-[(5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 142748593) has the molecular formula C19H18N4O6S and a molecular weight of 430.44 g/mol. Its IUPAC name is 6-[(5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 142748593 |
| Molecular Formula | C19H18N4O6S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 6-[(5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)S/C(=C\c2ccn(-c3ccc([N+](=O)[O-])cc3)n2)C1=O |
| InChI | InChI=1S/C19H18N4O6S/c24-17(25)4-2-1-3-10-21-18(26)16(30-19(21)27)12-13-9-11-22(20-13)14-5-7-15(8-6-14)23(28)29/h5-9,11-12H,1-4,10H2,(H,24,25)/b16-12- |
| InChIKey | BPMDACADYTYWSS-VBKFSLOCSA-N |
| XLogP | 3.46 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|