C18H15N3O5S — CID 142748622
(5Z)-3-(3-hydroxypropyl)-5-[[6-(4-nitrophenyl)-2-pyridinyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 142748622) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is (5Z)-3-(3-hydroxypropyl)-5-[[6-(4-nitrophenyl)-2-pyridinyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(3-hydroxypropyl)-5-[[6-(4-nitrophenyl)-2-pyridinyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 142748622 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (5Z)-3-(3-hydroxypropyl)-5-[[6-(4-nitrophenyl)-2-pyridinyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cccc(-c3ccc([N+](=O)[O-])cc3)n2)C(=O)N1CCCO |
| InChI | InChI=1S/C18H15N3O5S/c22-10-2-9-20-17(23)16(27-18(20)24)11-13-3-1-4-15(19-13)12-5-7-14(8-6-12)21(25)26/h1,3-8,11,22H,2,9-10H2/b16-11- |
| InChIKey | DHFKCRHLTOOKCQ-WJDWOHSUSA-N |
| XLogP | 3.08 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|