C24H15N3O4S — CID 74079361
5-(acridin-9-ylmethylidene)-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 74079361) has the molecular formula C24H15N3O4S and a molecular weight of 441.47 g/mol. Its IUPAC name is 5-(acridin-9-ylmethylidene)-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(acridin-9-ylmethylidene)-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 74079361 |
| Molecular Formula | C24H15N3O4S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 5-(acridin-9-ylmethylidene)-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2c3ccccc3nc3ccccc23)C(=O)N1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H15N3O4S/c28-23-22(32-24(29)26(23)14-15-9-11-16(12-10-15)27(30)31)13-19-17-5-1-3-7-20(17)25-21-8-4-2-6-18(19)21/h1-13H,14H2 |
| InChIKey | STEGWMUHYXHVNT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|