C24H15BrN2OS2 — CID 85089760
5-(acridin-9-ylmethylidene)-3-[(4-bromophenyl)methyl]-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 85089760) has the molecular formula C24H15BrN2OS2 and a molecular weight of 491.44 g/mol. Its IUPAC name is 5-(acridin-9-ylmethylidene)-3-[(4-bromophenyl)methyl]-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | 5-(acridin-9-ylmethylidene)-3-[(4-bromophenyl)methyl]-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 85089760 |
| Molecular Formula | C24H15BrN2OS2 |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 5-(acridin-9-ylmethylidene)-3-[(4-bromophenyl)methyl]-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | O=C1SC(=Cc2c3ccccc3nc3ccccc23)C(=S)N1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H15BrN2OS2/c25-16-11-9-15(10-12-16)14-27-23(29)22(30-24(27)28)13-19-17-5-1-3-7-20(17)26-21-8-4-2-6-18(19)21/h1-13H,14H2 |
| InChIKey | PMFHNKAMRKBPHB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|