C24H17N3OS — CID 23651803
(5Z)-5-(acridin-9-ylmethylidene)-1-benzyl-4-sulfanylideneimidazolidin-2-one (PubChem CID 23651803) has the molecular formula C24H17N3OS and a molecular weight of 395.49 g/mol. Its IUPAC name is (5Z)-5-(acridin-9-ylmethylidene)-1-benzyl-4-sulfanylideneimidazolidin-2-one.
| Compound Name | (5Z)-5-(acridin-9-ylmethylidene)-1-benzyl-4-sulfanylideneimidazolidin-2-one |
|---|---|
| PubChem CID | 23651803 |
| Molecular Formula | C24H17N3OS |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (5Z)-5-(acridin-9-ylmethylidene)-1-benzyl-4-sulfanylideneimidazolidin-2-one |
| SMILES | O=C1NC(=S)/C(=C/c2c3ccccc3nc3ccccc23)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H17N3OS/c28-24-26-23(29)22(27(24)15-16-8-2-1-3-9-16)14-19-17-10-4-6-12-20(17)25-21-13-7-5-11-18(19)21/h1-14H,15H2,(H,26,28,29)/b22-14- |
| InChIKey | YAFCHOAVGDAHGZ-HMAPJEAMSA-N |
| XLogP | 5.28 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|