C24H16N2O2S — CID 87709377
(5Z)-5-(acridin-9-ylmethylidene)-3-benzyl-1,3-thiazolidine-2,4-dione (PubChem CID 87709377) has the molecular formula C24H16N2O2S and a molecular weight of 396.47 g/mol. Its IUPAC name is (5Z)-5-(acridin-9-ylmethylidene)-3-benzyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-(acridin-9-ylmethylidene)-3-benzyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87709377 |
| Molecular Formula | C24H16N2O2S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (5Z)-5-(acridin-9-ylmethylidene)-3-benzyl-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2c3ccccc3nc3ccccc23)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H16N2O2S/c27-23-22(29-24(28)26(23)15-16-8-2-1-3-9-16)14-19-17-10-4-6-12-20(17)25-21-13-7-5-11-18(19)21/h1-14H,15H2/b22-14- |
| InChIKey | ZTVZKLWSVDAIBB-HMAPJEAMSA-N |
| XLogP | 5.62 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|