C24H28N6O6S — CID 142748583
N-(2-morpholin-4-ylethyl)-5-[(5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pentanamide (PubChem CID 142748583) has the molecular formula C24H28N6O6S and a molecular weight of 528.59 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-5-[(5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pentanamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-5-[(5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pentanamide |
|---|---|
| PubChem CID | 142748583 |
| Molecular Formula | C24H28N6O6S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-5-[(5Z)-5-[[1-(4-nitrophenyl)pyrazol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]pentanamide |
| SMILES | O=C(CCCCN1C(=O)S/C(=C\c2ccn(-c3ccc([N+](=O)[O-])cc3)n2)C1=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C24H28N6O6S/c31-22(25-9-12-27-13-15-36-16-14-27)3-1-2-10-28-23(32)21(37-24(28)33)17-18-8-11-29(26-18)19-4-6-20(7-5-19)30(34)35/h4-8,11,17H,1-3,9-10,12-16H2,(H,25,31)/b21-17- |
| InChIKey | TVLOKPUVJVUNLR-FXBPSFAMSA-N |
| XLogP | 2.44 |
| TPSA | 139.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|