C16H6Br2I2 — CID 142752006
2,7-dibromo-1,6-diiodopyrene (PubChem CID 142752006) has the molecular formula C16H6Br2I2 and a molecular weight of 611.84 g/mol. Its IUPAC name is 2,7-dibromo-1,6-diiodopyrene.
| Compound Name | 2,7-dibromo-1,6-diiodopyrene |
|---|---|
| PubChem CID | 142752006 |
| Molecular Formula | C16H6Br2I2 |
| Molecular Weight | 611.84 g/mol |
| Exact Mass | 609.69 |
| IUPAC Name | 2,7-dibromo-1,6-diiodopyrene |
| SMILES | Brc1cc2ccc3c(I)c(Br)cc4ccc(c1I)c2c43 |
| InChI | InChI=1S/C16H6Br2I2/c17-11-5-7-1-3-9-14-8(6-12(18)15(9)19)2-4-10(13(7)14)16(11)20/h1-6H |
| InChIKey | NUGHDJNTEGSVCA-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.84 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|