C31H33N7O6 — CID 142752770
4-[5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazine-1-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]benzamide (PubChem CID 142752770) has the molecular formula C31H33N7O6 and a molecular weight of 599.65 g/mol. Its IUPAC name is 4-[5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazine-1-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]benzamide.
| Compound Name | 4-[5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazine-1-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]benzamide |
|---|---|
| PubChem CID | 142752770 |
| Molecular Formula | C31H33N7O6 |
| Molecular Weight | 599.65 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 4-[5-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazine-1-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2CC3CN(C(=O)N4CCN(c5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6=O)CC4)CC3C2)cc1 |
| InChI | InChI=1S/C31H33N7O6/c32-27(40)18-1-3-21(4-2-18)36-14-19-16-37(17-20(19)15-36)31(44)35-11-9-34(10-12-35)22-5-6-23-24(13-22)30(43)38(29(23)42)25-7-8-26(39)33-28(25)41/h1-6,13,19-20,25H,7-12,14-17H2,(H2,32,40)(H,33,39,41) |
| InChIKey | OVDUJACIDQRHDZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 156.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.65 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|