C11H22F2O4Si2 — CID 142756203
(4R,5R)-3,3-difluoro-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-one (PubChem CID 142756203) has the molecular formula C11H22F2O4Si2 and a molecular weight of 312.46 g/mol. Its IUPAC name is (4R,5R)-3,3-difluoro-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-one.
| Compound Name | (4R,5R)-3,3-difluoro-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 142756203 |
| Molecular Formula | C11H22F2O4Si2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (4R,5R)-3,3-difluoro-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-one |
| SMILES | C[Si](C)(C)OC[C@H]1OC(=O)C(F)(F)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C11H22F2O4Si2/c1-18(2,3)15-7-8-9(17-19(4,5)6)11(12,13)10(14)16-8/h8-9H,7H2,1-6H3/t8-,9-/m1/s1 |
| InChIKey | NBVJQTDOOZVPPI-RKDXNWHRSA-N |
| XLogP | 2.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|