C28H44N2 — CID 142760344
2-(8-methylnonan-2-yl)-1-N-(4-methylpentan-2-yl)-4-N-phenylbenzene-1,4-diamine (PubChem CID 142760344) has the molecular formula C28H44N2 and a molecular weight of 408.67 g/mol. Its IUPAC name is 2-(8-methylnonan-2-yl)-1-N-(4-methylpentan-2-yl)-4-N-phenylbenzene-1,4-diamine.
| Compound Name | 2-(8-methylnonan-2-yl)-1-N-(4-methylpentan-2-yl)-4-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 142760344 |
| Molecular Formula | C28H44N2 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | 2-(8-methylnonan-2-yl)-1-N-(4-methylpentan-2-yl)-4-N-phenylbenzene-1,4-diamine |
| SMILES | CC(C)CCCCCC(C)c1cc(Nc2ccccc2)ccc1NC(C)CC(C)C |
| InChI | InChI=1S/C28H44N2/c1-21(2)13-9-7-10-14-23(5)27-20-26(30-25-15-11-8-12-16-25)17-18-28(27)29-24(6)19-22(3)4/h8,11-12,15-18,20-24,29-30H,7,9-10,13-14,19H2,1-6H3 |
| InChIKey | VJOQJLFCJVDTGC-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|