C24H26N2O6 — CID 142766683
methyl 2-[[[4-[2-[4-(dimethoxymethyl)phenyl]ethynyl]benzoyl]amino]methyl]-3-(methylamino)-3-oxopropanoate (PubChem CID 142766683) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl 2-[[[4-[2-[4-(dimethoxymethyl)phenyl]ethynyl]benzoyl]amino]methyl]-3-(methylamino)-3-oxopropanoate.
| Compound Name | methyl 2-[[[4-[2-[4-(dimethoxymethyl)phenyl]ethynyl]benzoyl]amino]methyl]-3-(methylamino)-3-oxopropanoate |
|---|---|
| PubChem CID | 142766683 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | methyl 2-[[[4-[2-[4-(dimethoxymethyl)phenyl]ethynyl]benzoyl]amino]methyl]-3-(methylamino)-3-oxopropanoate |
| SMILES | CNC(=O)C(CNC(=O)c1ccc(C#Cc2ccc(C(OC)OC)cc2)cc1)C(=O)OC |
| InChI | InChI=1S/C24H26N2O6/c1-25-22(28)20(23(29)30-2)15-26-21(27)18-11-7-16(8-12-18)5-6-17-9-13-19(14-10-17)24(31-3)32-4/h7-14,20,24H,15H2,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | NNXFCBHSALERBW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|