C18H11BrN2O4 — CID 142771041
1,3-dibenzoyl-5-bromopyrimidine-2,4-dione (PubChem CID 142771041) has the molecular formula C18H11BrN2O4 and a molecular weight of 399.20 g/mol. Its IUPAC name is 1,3-dibenzoyl-5-bromopyrimidine-2,4-dione.
| Compound Name | 1,3-dibenzoyl-5-bromopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142771041 |
| Molecular Formula | C18H11BrN2O4 |
| Molecular Weight | 399.20 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 1,3-dibenzoyl-5-bromopyrimidine-2,4-dione |
| SMILES | O=C(c1ccccc1)n1cc(Br)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C18H11BrN2O4/c19-14-11-20(15(22)12-7-3-1-4-8-12)18(25)21(17(14)24)16(23)13-9-5-2-6-10-13/h1-11H |
| InChIKey | PVVQFDLLMRJANZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |