C17H26Cl2N2O — CID 142774999
4,6-dichloro-5-(2-ethylbutyl)-1-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 142774999) has the molecular formula C17H26Cl2N2O and a molecular weight of 345.31 g/mol. Its IUPAC name is 4,6-dichloro-5-(2-ethylbutyl)-1-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 4,6-dichloro-5-(2-ethylbutyl)-1-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 142774999 |
| Molecular Formula | C17H26Cl2N2O |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4,6-dichloro-5-(2-ethylbutyl)-1-pyrrolidin-3-ylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | CCC(CC)CC1=C(Cl)C=CC(C(N)=O)(C2CCNC2)C1Cl |
| InChI | InChI=1S/C17H26Cl2N2O/c1-3-11(4-2)9-13-14(18)5-7-17(15(13)19,16(20)22)12-6-8-21-10-12/h5,7,11-12,15,21H,3-4,6,8-10H2,1-2H3,(H2,20,22) |
| InChIKey | DOVMTFXLLBXDQM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|