C15H22ClFN2O — CID 142774996
6-chloro-4-fluoro-5-(2-methylpropyl)-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide (PubChem CID 142774996) has the molecular formula C15H22ClFN2O and a molecular weight of 300.81 g/mol. Its IUPAC name is 6-chloro-4-fluoro-5-(2-methylpropyl)-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 6-chloro-4-fluoro-5-(2-methylpropyl)-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 142774996 |
| Molecular Formula | C15H22ClFN2O |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 6-chloro-4-fluoro-5-(2-methylpropyl)-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide |
| SMILES | CC(C)CC1(C2CCNC2)C(F)=CC=C(C(N)=O)C1Cl |
| InChI | InChI=1S/C15H22ClFN2O/c1-9(2)7-15(10-5-6-19-8-10)12(17)4-3-11(13(15)16)14(18)20/h3-4,9-10,13,19H,5-8H2,1-2H3,(H2,18,20) |
| InChIKey | KTUIUIOUYCLLSP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|