C15H21Cl3N2O — CID 142775009
3-butyl-4,5,6-trichloro-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide (PubChem CID 142775009) has the molecular formula C15H21Cl3N2O and a molecular weight of 351.71 g/mol. Its IUPAC name is 3-butyl-4,5,6-trichloro-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 3-butyl-4,5,6-trichloro-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 142775009 |
| Molecular Formula | C15H21Cl3N2O |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 3-butyl-4,5,6-trichloro-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide |
| SMILES | CCCCC1=C(Cl)C(Cl)(C2CCNC2)C(Cl)C(C(N)=O)=C1 |
| InChI | InChI=1S/C15H21Cl3N2O/c1-2-3-4-9-7-11(14(19)21)13(17)15(18,12(9)16)10-5-6-20-8-10/h7,10,13,20H,2-6,8H2,1H3,(H2,19,21) |
| InChIKey | ZFRHQBJQMFCMKR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|