C15H20Cl2N2O — CID 142775012
4,6-dichloro-5-cyclobutyl-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide (PubChem CID 142775012) has the molecular formula C15H20Cl2N2O and a molecular weight of 315.24 g/mol. Its IUPAC name is 4,6-dichloro-5-cyclobutyl-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 4,6-dichloro-5-cyclobutyl-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 142775012 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4,6-dichloro-5-cyclobutyl-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide |
| SMILES | NC(=O)C1=CC=C(Cl)C(C2CCC2)(C2CCNC2)C1Cl |
| InChI | InChI=1S/C15H20Cl2N2O/c16-12-5-4-11(14(18)20)13(17)15(12,9-2-1-3-9)10-6-7-19-8-10/h4-5,9-10,13,19H,1-3,6-8H2,(H2,18,20) |
| InChIKey | HJAYSRGTVWWJMY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|