C15H22Cl2N2O — CID 142775008
6-butyl-4,5-dichloro-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide (PubChem CID 142775008) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is 6-butyl-4,5-dichloro-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 6-butyl-4,5-dichloro-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 142775008 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 6-butyl-4,5-dichloro-5-pyrrolidin-3-ylcyclohexa-1,3-diene-1-carboxamide |
| SMILES | CCCCC1C(C(N)=O)=CC=C(Cl)C1(Cl)C1CCNC1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-2-3-4-12-11(14(18)20)5-6-13(16)15(12,17)10-7-8-19-9-10/h5-6,10,12,19H,2-4,7-9H2,1H3,(H2,18,20) |
| InChIKey | KMBQRVWYGPBHMZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|