C27H33N3O4S2 — CID 142776661
3-[methoxy-[5-[4-(3-propylanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide (PubChem CID 142776661) has the molecular formula C27H33N3O4S2 and a molecular weight of 527.71 g/mol. Its IUPAC name is 3-[methoxy-[5-[4-(3-propylanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide.
| Compound Name | 3-[methoxy-[5-[4-(3-propylanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 142776661 |
| Molecular Formula | C27H33N3O4S2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 3-[methoxy-[5-[4-(3-propylanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
| SMILES | CCCc1cccc(NC2CCN(S(=O)(=O)c3ccc(C(OC)c4cccc(C(N)=O)c4)s3)CC2)c1 |
| InChI | InChI=1S/C27H33N3O4S2/c1-3-6-19-7-4-10-23(17-19)29-22-13-15-30(16-14-22)36(32,33)25-12-11-24(35-25)26(34-2)20-8-5-9-21(18-20)27(28)31/h4-5,7-12,17-18,22,26,29H,3,6,13-16H2,1-2H3,(H2,28,31) |
| InChIKey | HWJIMYIKULDIOT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |