C17H19ClN4O2S3 — CID 142777032
4-[4-[(4-piperazin-1-ylthiophen-2-yl)sulfonylmethyl]phenyl]thiadiazole;hydrochloride (PubChem CID 142777032) has the molecular formula C17H19ClN4O2S3 and a molecular weight of 443.02 g/mol. Its IUPAC name is 4-[4-[(4-piperazin-1-ylthiophen-2-yl)sulfonylmethyl]phenyl]thiadiazole;hydrochloride.
| Compound Name | 4-[4-[(4-piperazin-1-ylthiophen-2-yl)sulfonylmethyl]phenyl]thiadiazole;hydrochloride |
|---|---|
| PubChem CID | 142777032 |
| Molecular Formula | C17H19ClN4O2S3 |
| Molecular Weight | 443.02 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 4-[4-[(4-piperazin-1-ylthiophen-2-yl)sulfonylmethyl]phenyl]thiadiazole;hydrochloride |
| SMILES | Cl.O=S(=O)(Cc1ccc(-c2csnn2)cc1)c1cc(N2CCNCC2)cs1 |
| InChI | InChI=1S/C17H18N4O2S3.ClH/c22-26(23,17-9-15(10-24-17)21-7-5-18-6-8-21)12-13-1-3-14(4-2-13)16-11-25-20-19-16;/h1-4,9-11,18H,5-8,12H2;1H |
| InChIKey | KOSCFFHXYUNGME-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.02 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |