C17H16F6N2O2S2 — CID 142780497
1-[5-[[2,5-bis(trifluoromethyl)phenyl]methylsulfonyl]thiophen-3-yl]piperazine (PubChem CID 142780497) has the molecular formula C17H16F6N2O2S2 and a molecular weight of 458.45 g/mol. Its IUPAC name is 1-[5-[[2,5-bis(trifluoromethyl)phenyl]methylsulfonyl]thiophen-3-yl]piperazine.
| Compound Name | 1-[5-[[2,5-bis(trifluoromethyl)phenyl]methylsulfonyl]thiophen-3-yl]piperazine |
|---|---|
| PubChem CID | 142780497 |
| Molecular Formula | C17H16F6N2O2S2 |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 1-[5-[[2,5-bis(trifluoromethyl)phenyl]methylsulfonyl]thiophen-3-yl]piperazine |
| SMILES | O=S(=O)(Cc1cc(C(F)(F)F)ccc1C(F)(F)F)c1cc(N2CCNCC2)cs1 |
| InChI | InChI=1S/C17H16F6N2O2S2/c18-16(19,20)12-1-2-14(17(21,22)23)11(7-12)10-29(26,27)15-8-13(9-28-15)25-5-3-24-4-6-25/h1-2,7-9,24H,3-6,10H2 |
| InChIKey | CAQYOKCDWXJBRR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |