C21H32BNO3 — CID 142779879
1-ethyl-4-methoxy-2-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 142779879) has the molecular formula C21H32BNO3 and a molecular weight of 357.30 g/mol. Its IUPAC name is 1-ethyl-4-methoxy-2-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-ethyl-4-methoxy-2-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 142779879 |
| Molecular Formula | C21H32BNO3 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 1-ethyl-4-methoxy-2-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CCn1c(B2OC(CC)(CC)C(CC)(CC)O2)cc2c(OC)cccc21 |
| InChI | InChI=1S/C21H32BNO3/c1-7-20(8-2)21(9-3,10-4)26-22(25-20)19-15-16-17(23(19)11-5)13-12-14-18(16)24-6/h12-15H,7-11H2,1-6H3 |
| InChIKey | JYKLCACMPOSZIJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|