C19H22N2O5S — CID 142782407
6-[(6-methyl-5,5-dioxo-11H-benzo[c][2,1,5]benzothiadiazepin-2-yl)oxy]hexanoic acid (PubChem CID 142782407) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 6-[(6-methyl-5,5-dioxo-11H-benzo[c][2,1,5]benzothiadiazepin-2-yl)oxy]hexanoic acid.
| Compound Name | 6-[(6-methyl-5,5-dioxo-11H-benzo[c][2,1,5]benzothiadiazepin-2-yl)oxy]hexanoic acid |
|---|---|
| PubChem CID | 142782407 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 6-[(6-methyl-5,5-dioxo-11H-benzo[c][2,1,5]benzothiadiazepin-2-yl)oxy]hexanoic acid |
| SMILES | CN1c2ccccc2Nc2cc(OCCCCCC(=O)O)ccc2S1(=O)=O |
| InChI | InChI=1S/C19H22N2O5S/c1-21-17-8-5-4-7-15(17)20-16-13-14(10-11-18(16)27(21,24)25)26-12-6-2-3-9-19(22)23/h4-5,7-8,10-11,13,20H,2-3,6,9,12H2,1H3,(H,22,23) |
| InChIKey | BZZQOFFRKBTISD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|