C21H27N3O5S — CID 142782384
6-[3-(dimethylamino)-9-methoxy-5,5-dioxo-11H-benzo[c][2,1,5]benzothiadiazepin-6-yl]hexanoic acid (PubChem CID 142782384) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is 6-[3-(dimethylamino)-9-methoxy-5,5-dioxo-11H-benzo[c][2,1,5]benzothiadiazepin-6-yl]hexanoic acid.
| Compound Name | 6-[3-(dimethylamino)-9-methoxy-5,5-dioxo-11H-benzo[c][2,1,5]benzothiadiazepin-6-yl]hexanoic acid |
|---|---|
| PubChem CID | 142782384 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 6-[3-(dimethylamino)-9-methoxy-5,5-dioxo-11H-benzo[c][2,1,5]benzothiadiazepin-6-yl]hexanoic acid |
| SMILES | COc1ccc2c(c1)Nc1ccc(N(C)C)cc1S(=O)(=O)N2CCCCCC(=O)O |
| InChI | InChI=1S/C21H27N3O5S/c1-23(2)15-8-10-17-20(13-15)30(27,28)24(12-6-4-5-7-21(25)26)19-11-9-16(29-3)14-18(19)22-17/h8-11,13-14,22H,4-7,12H2,1-3H3,(H,25,26) |
| InChIKey | CNHSXJUXRXDSHJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|