C21H22ClF3N2O5 — CID 142782852
3-[[3-(2-amino-4-chlorophenoxy)-1-phenylpropoxy]carbonylamino]propyl 2,2,2-trifluoroacetate (PubChem CID 142782852) has the molecular formula C21H22ClF3N2O5 and a molecular weight of 474.86 g/mol. Its IUPAC name is 3-[[3-(2-amino-4-chlorophenoxy)-1-phenylpropoxy]carbonylamino]propyl 2,2,2-trifluoroacetate.
| Compound Name | 3-[[3-(2-amino-4-chlorophenoxy)-1-phenylpropoxy]carbonylamino]propyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 142782852 |
| Molecular Formula | C21H22ClF3N2O5 |
| Molecular Weight | 474.86 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 3-[[3-(2-amino-4-chlorophenoxy)-1-phenylpropoxy]carbonylamino]propyl 2,2,2-trifluoroacetate |
| SMILES | Nc1cc(Cl)ccc1OCCC(OC(=O)NCCCOC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C21H22ClF3N2O5/c22-15-7-8-18(16(26)13-15)30-12-9-17(14-5-2-1-3-6-14)32-20(29)27-10-4-11-31-19(28)21(23,24)25/h1-3,5-8,13,17H,4,9-12,26H2,(H,27,29) |
| InChIKey | FECFELYGOANXGF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.86 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|