C14H19N3 — CID 142784086
2-(3-cyclohexyl-1,3-dihydropyrazol-2-yl)pyridine (PubChem CID 142784086) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 2-(3-cyclohexyl-1,3-dihydropyrazol-2-yl)pyridine.
| Compound Name | 2-(3-cyclohexyl-1,3-dihydropyrazol-2-yl)pyridine |
|---|---|
| PubChem CID | 142784086 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2-(3-cyclohexyl-1,3-dihydropyrazol-2-yl)pyridine |
| SMILES | C1=CC(C2CCCCC2)N(c2ccccn2)N1 |
| InChI | InChI=1S/C14H19N3/c1-2-6-12(7-3-1)13-9-11-16-17(13)14-8-4-5-10-15-14/h4-5,8-13,16H,1-3,6-7H2 |
| InChIKey | RBXOQNRKPZAUSQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |