C21H22ClN3O4S — CID 142784093
[2-[(4-tert-butylphenyl)sulfonylamino]-5-chlorophenyl] 5-methyl-1H-pyrazole-3-carboxylate (PubChem CID 142784093) has the molecular formula C21H22ClN3O4S and a molecular weight of 447.94 g/mol. Its IUPAC name is [2-[(4-tert-butylphenyl)sulfonylamino]-5-chlorophenyl] 5-methyl-1H-pyrazole-3-carboxylate.
| Compound Name | [2-[(4-tert-butylphenyl)sulfonylamino]-5-chlorophenyl] 5-methyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 142784093 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [2-[(4-tert-butylphenyl)sulfonylamino]-5-chlorophenyl] 5-methyl-1H-pyrazole-3-carboxylate |
| SMILES | Cc1cc(C(=O)Oc2cc(Cl)ccc2NS(=O)(=O)c2ccc(C(C)(C)C)cc2)n[nH]1 |
| InChI | InChI=1S/C21H22ClN3O4S/c1-13-11-18(24-23-13)20(26)29-19-12-15(22)7-10-17(19)25-30(27,28)16-8-5-14(6-9-16)21(2,3)4/h5-12,25H,1-4H3,(H,23,24) |
| InChIKey | SCYGVOKQZDKHID-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|