C10H12Cl2N2O — CID 142786096
3-(5,6-dichloro-2-pyridinyl)-2,2-dimethylpropanamide (PubChem CID 142786096) has the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. Its IUPAC name is 3-(5,6-dichloro-2-pyridinyl)-2,2-dimethylpropanamide.
| Compound Name | 3-(5,6-dichloro-2-pyridinyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 142786096 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 3-(5,6-dichloro-2-pyridinyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(Cc1ccc(Cl)c(Cl)n1)C(N)=O |
| InChI | InChI=1S/C10H12Cl2N2O/c1-10(2,9(13)15)5-6-3-4-7(11)8(12)14-6/h3-4H,5H2,1-2H3,(H2,13,15) |
| InChIKey | CPXZDXVMMZNVSC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|