2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid

C7H5Cl2F2NO2 — CID 174737503

IUPAC2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid
SMILESFc1ccc(Cl)c(Cl)n1.O=C(O)CF
InChIInChI=1S/C5H2Cl2FN.C2H3FO2/c6-3-1-2-4(8)9-5(3)7;3-1-2(4)5/h1-2H;1H2,(H,4,5)
InChIKeyHXAYUYYWAQKLEO-UHFFFAOYSA-N
MW244.02 g/mol
LogP2.57
Rot. Bonds1

About 2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid

2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid (PubChem CID 174737503) has the molecular formula C7H5Cl2F2NO2 and a molecular weight of 244.02 g/mol. Its IUPAC name is 2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid.

Molecular Properties

Compound Name2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid
PubChem CID174737503
Molecular FormulaC7H5Cl2F2NO2
Molecular Weight244.02 g/mol
Exact Mass242.97
IUPAC Name2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid
SMILESFc1ccc(Cl)c(Cl)n1.O=C(O)CF
InChIInChI=1S/C5H2Cl2FN.C2H3FO2/c6-3-1-2-4(8)9-5(3)7;3-1-2(4)5/h1-2H;1H2,(H,4,5)
InChIKeyHXAYUYYWAQKLEO-UHFFFAOYSA-N
XLogP2.57
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.02
LogP ≤ 52.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-fluoroacetic acid;1,2,3,4-tetrachlorobenzene
CID 174356728
2-[2-(2,5-dichlorophenyl)-6-fluoro-3-pyridinyl]acetic acid
CID 133090909
2-(2,6-difluoro-3-pyridinyl)acetic acid
CID 118998440
2-[6-fluoro-3-(3,4,5-trichlorophenyl)-2-pyridinyl]acetic acid
CID 133090419
2-[6-fluoro-2-(2,3,5-trichlorophenyl)-3-pyridinyl]acetic acid
CID 134637599
3-(5,6-dichloro-2-pyridinyl)-2,2-dimethylpropanamide
CID 142786096
5,6-dichloropyridine-2-carboxylate
CID 86306959
2-(2,5-dichlorophenyl)-6-fluoropyridine-3-carboxylic acid
CID 118813640
2-[3-(3,5-dichlorophenyl)-6-fluoro-2-pyridinyl]acetic acid
CID 133090701
3-(5,6-dichloro-2-pyridinyl)prop-2-enoic acid
CID 173482984
2-(2,6-dichlorophenyl)-6-fluoropyridine-3-carboxylic acid
CID 118836187
2-fluoroacetic acid;hydrochloride
CID 87782456

Frequently Asked Questions

What is the IUPAC name of 2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid?
The IUPAC name of 2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid (CID 174737503) is 2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid.
What is the SMILES notation for 2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid?
The canonical SMILES for 2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid is Fc1ccc(Cl)c(Cl)n1.O=C(O)CF.
What is the InChIKey of 2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid?
The InChIKey is HXAYUYYWAQKLEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2Cl2FN.C2H3FO2/c6-3-1-2-4(8)9-5(3)7;3-1-2(4)5/h1-2H;1H2,(H,4,5).
What are the key properties of 2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid?
2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid has a molecular weight of 244.02 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-6-fluoropyridine;2-fluoroacetic acid is sourced from PubChem (CID 174737503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).